C30H51NO — CID 54753193
3-[5-[(Z)-dec-1-enyl]-3-[(E)-dec-1-enyl]-4,6-dimethyl-2-pyridinyl]propan-1-ol (PubChem CID 54753193) has the molecular formula C30H51NO and a molecular weight of 441.74 g/mol. Its IUPAC name is 3-[5-[(Z)-dec-1-enyl]-3-[(E)-dec-1-enyl]-4,6-dimethyl-2-pyridinyl]propan-1-ol.
| Compound Name | 3-[5-[(Z)-dec-1-enyl]-3-[(E)-dec-1-enyl]-4,6-dimethyl-2-pyridinyl]propan-1-ol |
|---|---|
| PubChem CID | 54753193 |
| Molecular Formula | C30H51NO |
| Molecular Weight | 441.74 g/mol |
| Exact Mass | 441.40 |
| IUPAC Name | 3-[5-[(Z)-dec-1-enyl]-3-[(E)-dec-1-enyl]-4,6-dimethyl-2-pyridinyl]propan-1-ol |
| SMILES | CCCCCCCC/C=C\c1c(C)nc(CCCO)c(/C=C/CCCCCCCC)c1C |
| InChI | InChI=1S/C30H51NO/c1-5-7-9-11-13-15-17-19-22-28-26(3)29(30(24-21-25-32)31-27(28)4)23-20-18-16-14-12-10-8-6-2/h19-20,22-23,32H,5-18,21,24-25H2,1-4H3/b22-19-,23-20+ |
| InChIKey | BBIHADVXXJRNBU-XOODDYIFSA-N |
| XLogP | 9.15 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.74 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|