C38H59NO2 — CID 16658559
3,5-bis[(Z)-dec-1-enyl]-2-[3-[(4-methoxyphenyl)methoxy]propyl]-4,6-dimethylpyridine (PubChem CID 16658559) has the molecular formula C38H59NO2 and a molecular weight of 561.90 g/mol. Its IUPAC name is 3,5-bis[(Z)-dec-1-enyl]-2-[3-[(4-methoxyphenyl)methoxy]propyl]-4,6-dimethylpyridine.
| Compound Name | 3,5-bis[(Z)-dec-1-enyl]-2-[3-[(4-methoxyphenyl)methoxy]propyl]-4,6-dimethylpyridine |
|---|---|
| PubChem CID | 16658559 |
| Molecular Formula | C38H59NO2 |
| Molecular Weight | 561.90 g/mol |
| Exact Mass | 561.45 |
| IUPAC Name | 3,5-bis[(Z)-dec-1-enyl]-2-[3-[(4-methoxyphenyl)methoxy]propyl]-4,6-dimethylpyridine |
| SMILES | CCCCCCCC/C=C\c1c(C)nc(CCCOCc2ccc(OC)cc2)c(/C=C\CCCCCCCC)c1C |
| InChI | InChI=1S/C38H59NO2/c1-6-8-10-12-14-16-18-20-23-36-32(3)37(24-21-19-17-15-13-11-9-7-2)38(39-33(36)4)25-22-30-41-31-34-26-28-35(40-5)29-27-34/h20-21,23-24,26-29H,6-19,22,25,30-31H2,1-5H3/b23-20-,24-21- |
| InChIKey | JNYBCSSMGGLIST-XFUYORNGSA-N |
| XLogP | 11.38 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.90 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|