About 3-hex-1-enyl-2,4-dimethylquinoline
3-hex-1-enyl-2,4-dimethylquinoline (PubChem CID 70124767) has the molecular formula C17H21N
and a molecular weight of 239.36 g/mol. Its IUPAC name is 3-hex-1-enyl-2,4-dimethylquinoline.
Molecular Properties
| Compound Name | 3-hex-1-enyl-2,4-dimethylquinoline |
| PubChem CID | 70124767 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3-hex-1-enyl-2,4-dimethylquinoline |
| SMILES | CCCCC=Cc1c(C)nc2ccccc2c1C |
| InChI | InChI=1S/C17H21N/c1-4-5-6-7-10-15-13(2)16-11-8-9-12-17(16)18-14(15)3/h7-12H,4-6H2,1-3H3 |
| InChIKey | YPGXLFKQOVBMEC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hex-1-enyl-2,4-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hex-1-enyl-2,4-dimethylquinoline?
The IUPAC name of 3-hex-1-enyl-2,4-dimethylquinoline (CID 70124767) is 3-hex-1-enyl-2,4-dimethylquinoline.
What is the SMILES notation for 3-hex-1-enyl-2,4-dimethylquinoline?
The canonical SMILES for 3-hex-1-enyl-2,4-dimethylquinoline is CCCCC=Cc1c(C)nc2ccccc2c1C.
What is the InChIKey of 3-hex-1-enyl-2,4-dimethylquinoline?
The InChIKey is YPGXLFKQOVBMEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N/c1-4-5-6-7-10-15-13(2)16-11-8-9-12-17(16)18-14(15)3/h7-12H,4-6H2,1-3H3.
What are the key properties of 3-hex-1-enyl-2,4-dimethylquinoline?
3-hex-1-enyl-2,4-dimethylquinoline has a molecular weight of 239.36 g/mol, XLogP of 5.06, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hex-1-enyl-2,4-dimethylquinoline is sourced from PubChem (CID 70124767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).