C17H21N — CID 70124767
3-hex-1-enyl-2,4-dimethylquinoline (PubChem CID 70124767) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is 3-hex-1-enyl-2,4-dimethylquinoline.
| Compound Name | 3-hex-1-enyl-2,4-dimethylquinoline |
|---|---|
| PubChem CID | 70124767 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3-hex-1-enyl-2,4-dimethylquinoline |
| SMILES | CCCCC=Cc1c(C)nc2ccccc2c1C |
| InChI | InChI=1S/C17H21N/c1-4-5-6-7-10-15-13(2)16-11-8-9-12-17(16)18-14(15)3/h7-12H,4-6H2,1-3H3 |
| InChIKey | YPGXLFKQOVBMEC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|