C24H34N2 — CID 157427941
1-(2,4-dimethylquinolin-3-yl)-N-phenylmethanimine;ethane (PubChem CID 157427941) has the molecular formula C24H34N2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 1-(2,4-dimethylquinolin-3-yl)-N-phenylmethanimine;ethane.
| Compound Name | 1-(2,4-dimethylquinolin-3-yl)-N-phenylmethanimine;ethane |
|---|---|
| PubChem CID | 157427941 |
| Molecular Formula | C24H34N2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 1-(2,4-dimethylquinolin-3-yl)-N-phenylmethanimine;ethane |
| SMILES | CC.CC.CC.Cc1nc2ccccc2c(C)c1/C=N/c1ccccc1 |
| InChI | InChI=1S/C18H16N2.3C2H6/c1-13-16-10-6-7-11-18(16)20-14(2)17(13)12-19-15-8-4-3-5-9-15;3*1-2/h3-12H,1-2H3;3*1-2H3/b19-12+;;; |
| InChIKey | BQEJRHJQCSAFQG-VEWWMAHHSA-N |
| XLogP | 7.68 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|