C18H27N — CID 143448239
(2E,3Z)-2,3-di(ethylidene)-4-methylquinoline;ethane (PubChem CID 143448239) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is (2E,3Z)-2,3-di(ethylidene)-4-methylquinoline;ethane.
| Compound Name | (2E,3Z)-2,3-di(ethylidene)-4-methylquinoline;ethane |
|---|---|
| PubChem CID | 143448239 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | (2E,3Z)-2,3-di(ethylidene)-4-methylquinoline;ethane |
| SMILES | C/C=c1/c(C)c2ccccc2n/c1=C/C.CC.CC |
| InChI | InChI=1S/C14H15N.2C2H6/c1-4-11-10(3)12-8-6-7-9-14(12)15-13(11)5-2;2*1-2/h4-9H,1-3H3;2*1-2H3/b11-4-,13-5+;; |
| InChIKey | WMZNQGKNFHLQTE-ZMKDPNENSA-N |
| XLogP | 4.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |