C18H17NO — CID 143798134
ethane;11-methyl-[1]benzofuro[3,2-b]quinoline (PubChem CID 143798134) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is ethane;11-methyl-[1]benzofuro[3,2-b]quinoline.
| Compound Name | ethane;11-methyl-[1]benzofuro[3,2-b]quinoline |
|---|---|
| PubChem CID | 143798134 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | ethane;11-methyl-[1]benzofuro[3,2-b]quinoline |
| SMILES | CC.Cc1c2ccccc2nc2c1oc1ccccc12 |
| InChI | InChI=1S/C16H11NO.C2H6/c1-10-11-6-2-4-8-13(11)17-15-12-7-3-5-9-14(12)18-16(10)15;1-2/h2-9H,1H3;1-2H3 |
| InChIKey | SDRHJIDCMSNUPY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |