C11H7ClN2O — CID 603361
4-chloro-2-methyl-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 603361) has the molecular formula C11H7ClN2O and a molecular weight of 218.64 g/mol. Its IUPAC name is 4-chloro-2-methyl-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 4-chloro-2-methyl-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 603361 |
| Molecular Formula | C11H7ClN2O |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 4-chloro-2-methyl-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | Cc1nc(Cl)c2oc3ccccc3c2n1 |
| InChI | InChI=1S/C11H7ClN2O/c1-6-13-9-7-4-2-3-5-8(7)15-10(9)11(12)14-6/h2-5H,1H3 |
| InChIKey | GXGXMTZNONDUMY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |