C14H11ClN2O2 — CID 99987817
4-chloro-2-[(2R)-oxolan-2-yl]-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 99987817) has the molecular formula C14H11ClN2O2 and a molecular weight of 274.71 g/mol. Its IUPAC name is 4-chloro-2-[(2R)-oxolan-2-yl]-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 4-chloro-2-[(2R)-oxolan-2-yl]-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 99987817 |
| Molecular Formula | C14H11ClN2O2 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 4-chloro-2-[(2R)-oxolan-2-yl]-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | Clc1nc([C@H]2CCCO2)nc2c1oc1ccccc12 |
| InChI | InChI=1S/C14H11ClN2O2/c15-13-12-11(8-4-1-2-5-9(8)19-12)16-14(17-13)10-6-3-7-18-10/h1-2,4-5,10H,3,6-7H2/t10-/m1/s1 |
| InChIKey | HELRCJRWESLSOG-SNVBAGLBSA-N |
| XLogP | 3.88 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |