C11H6ClFN2O — CID 166124722
4-chloro-2-(fluoromethyl)-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 166124722) has the molecular formula C11H6ClFN2O and a molecular weight of 236.63 g/mol. Its IUPAC name is 4-chloro-2-(fluoromethyl)-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 4-chloro-2-(fluoromethyl)-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 166124722 |
| Molecular Formula | C11H6ClFN2O |
| Molecular Weight | 236.63 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 4-chloro-2-(fluoromethyl)-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | FCc1nc(Cl)c2oc3ccccc3c2n1 |
| InChI | InChI=1S/C11H6ClFN2O/c12-11-10-9(14-8(5-13)15-11)6-3-1-2-4-7(6)16-10/h1-4H,5H2 |
| InChIKey | GJACRRQTMLRBQT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.63 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |