C15H16N2O — CID 170017001
2-ethyl-4-propan-2-yl-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 170017001) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-ethyl-4-propan-2-yl-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 2-ethyl-4-propan-2-yl-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 170017001 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-ethyl-4-propan-2-yl-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | CCc1nc(C(C)C)c2oc3ccccc3c2n1 |
| InChI | InChI=1S/C15H16N2O/c1-4-12-16-13(9(2)3)15-14(17-12)10-7-5-6-8-11(10)18-15/h5-9H,4H2,1-3H3 |
| InChIKey | JLOOVYPNKQEEPH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |