C18H22N3O+ — CID 4916684
cyclohexyl-(2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)azanium (PubChem CID 4916684) has the molecular formula C18H22N3O+ and a molecular weight of 296.39 g/mol. Its IUPAC name is cyclohexyl-(2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)azanium.
| Compound Name | cyclohexyl-(2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)azanium |
|---|---|
| PubChem CID | 4916684 |
| Molecular Formula | C18H22N3O+ |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | cyclohexyl-(2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)azanium |
| SMILES | CCc1nc([NH2+]C2CCCCC2)c2oc3ccccc3c2n1 |
| InChI | InChI=1S/C18H21N3O/c1-2-15-20-16-13-10-6-7-11-14(13)22-17(16)18(21-15)19-12-8-4-3-5-9-12/h6-7,10-12H,2-5,8-9H2,1H3,(H,19,20,21)/p+1 |
| InChIKey | ZIFFMNQCGYNRPI-UHFFFAOYSA-O |
| XLogP | 3.47 |
| TPSA | 55.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |