C19H15N3O3 — CID 44664615
3-[(2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)azaniumyl]benzoate (PubChem CID 44664615) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 3-[(2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)azaniumyl]benzoate.
| Compound Name | 3-[(2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)azaniumyl]benzoate |
|---|---|
| PubChem CID | 44664615 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-[(2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)azaniumyl]benzoate |
| SMILES | CCc1nc([NH2+]c2cccc(C(=O)[O-])c2)c2oc3ccccc3c2n1 |
| InChI | InChI=1S/C19H15N3O3/c1-2-15-21-16-13-8-3-4-9-14(13)25-17(16)18(22-15)20-12-7-5-6-11(10-12)19(23)24/h3-10H,2H2,1H3,(H,23,24)(H,20,21,22) |
| InChIKey | INFNDJLKCPPBDW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|