C16H19N3O — CID 6546532
N-[(2S)-butan-2-yl]-2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine (PubChem CID 6546532) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[(2S)-butan-2-yl]-2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 6546532 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-amine |
| SMILES | CCc1nc(N[C@@H](C)CC)c2oc3ccccc3c2n1 |
| InChI | InChI=1S/C16H19N3O/c1-4-10(3)17-16-15-14(18-13(5-2)19-16)11-8-6-7-9-12(11)20-15/h6-10H,4-5H2,1-3H3,(H,17,18,19)/t10-/m0/s1 |
| InChIKey | GYIWGAHDUBCIRR-JTQLQIEISA-N |
| XLogP | 4.15 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |