C14H16N3O+ — CID 4976806
(2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)-dimethylazanium (PubChem CID 4976806) has the molecular formula C14H16N3O+ and a molecular weight of 242.30 g/mol. Its IUPAC name is (2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)-dimethylazanium.
| Compound Name | (2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)-dimethylazanium |
|---|---|
| PubChem CID | 4976806 |
| Molecular Formula | C14H16N3O+ |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (2-ethyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)-dimethylazanium |
| SMILES | CCc1nc([NH+](C)C)c2oc3ccccc3c2n1 |
| InChI | InChI=1S/C14H15N3O/c1-4-11-15-12-9-7-5-6-8-10(9)18-13(12)14(16-11)17(2)3/h5-8H,4H2,1-3H3/p+1 |
| InChIKey | LPGPQWYYCGMSSW-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 43.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |