C14H14N2O2 — CID 171560459
2-(ethoxymethyl)-4-methyl-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 171560459) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(ethoxymethyl)-4-methyl-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 2-(ethoxymethyl)-4-methyl-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 171560459 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(ethoxymethyl)-4-methyl-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | CCOCc1nc(C)c2oc3ccccc3c2n1 |
| InChI | InChI=1S/C14H14N2O2/c1-3-17-8-12-15-9(2)14-13(16-12)10-6-4-5-7-11(10)18-14/h4-7H,3,8H2,1-2H3 |
| InChIKey | HFOTYRMVRNCALF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |