C17H14ClN3O2 — CID 44664781
(4-hydroxyphenyl)-(2-methyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)azanium chloride (PubChem CID 44664781) has the molecular formula C17H14ClN3O2 and a molecular weight of 327.77 g/mol. Its IUPAC name is (4-hydroxyphenyl)-(2-methyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)azanium chloride.
| Compound Name | (4-hydroxyphenyl)-(2-methyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)azanium chloride |
|---|---|
| PubChem CID | 44664781 |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | (4-hydroxyphenyl)-(2-methyl-[1]benzofuro[3,2-d]pyrimidin-4-yl)azanium chloride |
| SMILES | Cc1nc([NH2+]c2ccc(O)cc2)c2oc3ccccc3c2n1.[Cl-] |
| InChI | InChI=1S/C17H13N3O2.ClH/c1-10-18-15-13-4-2-3-5-14(13)22-16(15)17(19-10)20-11-6-8-12(21)9-7-11;/h2-9,21H,1H3,(H,18,19,20);1H |
| InChIKey | FRBSFOLBIQEUHB-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|