C15H10N2O — CID 143056669
[1]benzofuro[3,2-b]quinolin-11-amine (PubChem CID 143056669) has the molecular formula C15H10N2O and a molecular weight of 234.26 g/mol. Its IUPAC name is [1]benzofuro[3,2-b]quinolin-11-amine.
| Compound Name | [1]benzofuro[3,2-b]quinolin-11-amine |
|---|---|
| PubChem CID | 143056669 |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | [1]benzofuro[3,2-b]quinolin-11-amine |
| SMILES | Nc1c2ccccc2nc2c1oc1ccccc12 |
| InChI | InChI=1S/C15H10N2O/c16-13-9-5-1-3-7-11(9)17-14-10-6-2-4-8-12(10)18-15(13)14/h1-8H,(H2,16,17) |
| InChIKey | QHXZLBMOFBYAPU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |