C11H10ClN3O — CID 135958604
2-methyl-[1]benzofuro[3,2-d]pyrimidin-3-ium-4-amine chloride (PubChem CID 135958604) has the molecular formula C11H10ClN3O and a molecular weight of 235.67 g/mol. Its IUPAC name is 2-methyl-[1]benzofuro[3,2-d]pyrimidin-3-ium-4-amine chloride.
| Compound Name | 2-methyl-[1]benzofuro[3,2-d]pyrimidin-3-ium-4-amine chloride |
|---|---|
| PubChem CID | 135958604 |
| Molecular Formula | C11H10ClN3O |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-methyl-[1]benzofuro[3,2-d]pyrimidin-3-ium-4-amine chloride |
| SMILES | Cc1nc2c(oc3ccccc32)c(N)[nH+]1.[Cl-] |
| InChI | InChI=1S/C11H9N3O.ClH/c1-6-13-9-7-4-2-3-5-8(7)15-10(9)11(12)14-6;/h2-5H,1H3,(H2,12,13,14);1H |
| InChIKey | FCBJJUALDKEWOB-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 66.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |