C16H13ClF2N2O4 — CID 171560129
2-[4-(4-chloro-[1]benzofuro[3,2-d]pyrimidin-2-yl)-4,4-difluorobutoxy]acetic acid (PubChem CID 171560129) has the molecular formula C16H13ClF2N2O4 and a molecular weight of 370.74 g/mol. Its IUPAC name is 2-[4-(4-chloro-[1]benzofuro[3,2-d]pyrimidin-2-yl)-4,4-difluorobutoxy]acetic acid.
| Compound Name | 2-[4-(4-chloro-[1]benzofuro[3,2-d]pyrimidin-2-yl)-4,4-difluorobutoxy]acetic acid |
|---|---|
| PubChem CID | 171560129 |
| Molecular Formula | C16H13ClF2N2O4 |
| Molecular Weight | 370.74 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 2-[4-(4-chloro-[1]benzofuro[3,2-d]pyrimidin-2-yl)-4,4-difluorobutoxy]acetic acid |
| SMILES | O=C(O)COCCCC(F)(F)c1nc(Cl)c2oc3ccccc3c2n1 |
| InChI | InChI=1S/C16H13ClF2N2O4/c17-14-13-12(9-4-1-2-5-10(9)25-13)20-15(21-14)16(18,19)6-3-7-24-8-11(22)23/h1-2,4-5H,3,6-8H2,(H,22,23) |
| InChIKey | GVGGVPMQENUZEN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.74 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|