C20H21F2N3O4 — CID 171560193
2-[4,4-difluoro-4-(4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-yl)butoxy]acetic acid (PubChem CID 171560193) has the molecular formula C20H21F2N3O4 and a molecular weight of 405.40 g/mol. Its IUPAC name is 2-[4,4-difluoro-4-(4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-yl)butoxy]acetic acid.
| Compound Name | 2-[4,4-difluoro-4-(4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-yl)butoxy]acetic acid |
|---|---|
| PubChem CID | 171560193 |
| Molecular Formula | C20H21F2N3O4 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[4,4-difluoro-4-(4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidin-2-yl)butoxy]acetic acid |
| SMILES | O=C(O)COCCCC(F)(F)c1nc(N2CCCC2)c2oc3ccccc3c2n1 |
| InChI | InChI=1S/C20H21F2N3O4/c21-20(22,8-5-11-28-12-15(26)27)19-23-16-13-6-1-2-7-14(13)29-17(16)18(24-19)25-9-3-4-10-25/h1-2,6-7H,3-5,8-12H2,(H,26,27) |
| InChIKey | WXDPXQMHOGFHMS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|