C18H17F2N3O2 — CID 171560233
2-[difluoro(prop-2-enoxy)methyl]-4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 171560233) has the molecular formula C18H17F2N3O2 and a molecular weight of 345.35 g/mol. Its IUPAC name is 2-[difluoro(prop-2-enoxy)methyl]-4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 2-[difluoro(prop-2-enoxy)methyl]-4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 171560233 |
| Molecular Formula | C18H17F2N3O2 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-[difluoro(prop-2-enoxy)methyl]-4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | C=CCOC(F)(F)c1nc(N2CCCC2)c2oc3ccccc3c2n1 |
| InChI | InChI=1S/C18H17F2N3O2/c1-2-11-24-18(19,20)17-21-14-12-7-3-4-8-13(12)25-15(14)16(22-17)23-9-5-6-10-23/h2-4,7-8H,1,5-6,9-11H2 |
| InChIKey | LCVVYJDVRPGMEJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|