C26H37N3O5 — CID 171560223
tert-butyl formate;formic acid;2-hexyl-4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 171560223) has the molecular formula C26H37N3O5 and a molecular weight of 471.60 g/mol. Its IUPAC name is tert-butyl formate;formic acid;2-hexyl-4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | tert-butyl formate;formic acid;2-hexyl-4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 171560223 |
| Molecular Formula | C26H37N3O5 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | tert-butyl formate;formic acid;2-hexyl-4-pyrrolidin-1-yl-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | CC(C)(C)OC=O.CCCCCCc1nc(N2CCCC2)c2oc3ccccc3c2n1.O=CO |
| InChI | InChI=1S/C20H25N3O.C5H10O2.CH2O2/c1-2-3-4-5-12-17-21-18-15-10-6-7-11-16(15)24-19(18)20(22-17)23-13-8-9-14-23;1-5(2,3)7-4-6;2-1-3/h6-7,10-11H,2-5,8-9,12-14H2,1H3;4H,1-3H3;1H,(H,2,3) |
| InChIKey | YFGKDWDKQGEAOX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|