C24H21N — CID 143445076
(2E,3Z)-2,3-di(ethylidene)-6-(10-methylanthracen-9-yl)pyridine (PubChem CID 143445076) has the molecular formula C24H21N and a molecular weight of 323.44 g/mol. Its IUPAC name is (2E,3Z)-2,3-di(ethylidene)-6-(10-methylanthracen-9-yl)pyridine.
| Compound Name | (2E,3Z)-2,3-di(ethylidene)-6-(10-methylanthracen-9-yl)pyridine |
|---|---|
| PubChem CID | 143445076 |
| Molecular Formula | C24H21N |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (2E,3Z)-2,3-di(ethylidene)-6-(10-methylanthracen-9-yl)pyridine |
| SMILES | C/C=c1/ccc(-c2c3ccccc3c(C)c3ccccc23)n/c1=C/C |
| InChI | InChI=1S/C24H21N/c1-4-17-14-15-23(25-22(17)5-2)24-20-12-8-6-10-18(20)16(3)19-11-7-9-13-21(19)24/h4-15H,1-3H3/b17-4-,22-5+ |
| InChIKey | MZHZTWRBFNLQSH-KGGMIOFLSA-N |
| XLogP | 4.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|