About (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane
(5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane (PubChem CID 123449612) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane.
Analyze (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane?
The IUPAC name of (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane (CID 123449612) is (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane.
What is the SMILES notation for (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane?
The canonical SMILES for (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane is C/C=c1/cccc/c1=C/C.CC.
What is the InChIKey of (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane?
The InChIKey is TWOSVNUGBFVRKP-NALDQGCSSA-N. The full InChI is InChI=1S/C10H12.C2H6/c1-3-9-7-5-6-8-10(9)4-2;1-2/h3-8H,1-2H3;1-2H3/b9-3-,10-4-;.
What are the key properties of (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane?
(5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane has a molecular weight of 162.28 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane is sourced from PubChem (CID 123449612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).