C18H30 — CID 161028149
(5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;(2Z,4Z)-hexa-2,4-diene;methane (PubChem CID 161028149) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;(2Z,4Z)-hexa-2,4-diene;methane.
| Compound Name | (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;(2Z,4Z)-hexa-2,4-diene;methane |
|---|---|
| PubChem CID | 161028149 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;(2Z,4Z)-hexa-2,4-diene;methane |
| SMILES | C.C.C/C=C\C=C/C.C/C=c1/cccc/c1=C/C |
| InChI | InChI=1S/C10H12.C6H10.2CH4/c1-3-9-7-5-6-8-10(9)4-2;1-3-5-6-4-2;;/h3-8H,1-2H3;3-6H,1-2H3;2*1H4/b9-3-,10-4-;5-3-,6-4-;; |
| InChIKey | TZGKYNHATPXEAY-ZKIOOHCNSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|