C27H23N — CID 175084711
1,1'-biphenyl;1,2-dimethylacridine (PubChem CID 175084711) has the molecular formula C27H23N and a molecular weight of 361.49 g/mol. Its IUPAC name is 1,1'-biphenyl;1,2-dimethylacridine.
| Compound Name | 1,1'-biphenyl;1,2-dimethylacridine |
|---|---|
| PubChem CID | 175084711 |
| Molecular Formula | C27H23N |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1,1'-biphenyl;1,2-dimethylacridine |
| SMILES | Cc1ccc2nc3ccccc3cc2c1C.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H13N.C12H10/c1-10-7-8-15-13(11(10)2)9-12-5-3-4-6-14(12)16-15;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h3-9H,1-2H3;1-10H |
| InChIKey | SXLDALFNHCVEBX-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|