C20H17Cl2FeN3 — CID 70013505
iron(2+);1-[4-methyl-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;dichloride (PubChem CID 70013505) has the molecular formula C20H17Cl2FeN3 and a molecular weight of 426.13 g/mol. Its IUPAC name is iron(2+);1-[4-methyl-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;dichloride.
| Compound Name | iron(2+);1-[4-methyl-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;dichloride |
|---|---|
| PubChem CID | 70013505 |
| Molecular Formula | C20H17Cl2FeN3 |
| Molecular Weight | 426.13 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | iron(2+);1-[4-methyl-6-(phenyliminomethyl)-2-pyridinyl]-N-phenylmethanimine;dichloride |
| SMILES | Cc1cc(/C=N/c2ccccc2)nc(/C=N/c2ccccc2)c1.[Cl-].[Cl-].[Fe+2] |
| InChI | InChI=1S/C20H17N3.2ClH.Fe/c1-16-12-19(14-21-17-8-4-2-5-9-17)23-20(13-16)15-22-18-10-6-3-7-11-18;;;/h2-15H,1H3;2*1H;/q;;;+2/p-2/b21-14+,22-15+;;; |
| InChIKey | YYJKCJCLLIBHLD-YMZCCZLVSA-L |
| XLogP | -1.10 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.13 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|