C25H44 — CID 140993101
1-propyl-3,5-bis(2,4,4-trimethylpentan-2-yl)benzene (PubChem CID 140993101) has the molecular formula C25H44 and a molecular weight of 344.63 g/mol. Its IUPAC name is 1-propyl-3,5-bis(2,4,4-trimethylpentan-2-yl)benzene.
| Compound Name | 1-propyl-3,5-bis(2,4,4-trimethylpentan-2-yl)benzene |
|---|---|
| PubChem CID | 140993101 |
| Molecular Formula | C25H44 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 344.34 |
| IUPAC Name | 1-propyl-3,5-bis(2,4,4-trimethylpentan-2-yl)benzene |
| SMILES | CCCc1cc(C(C)(C)CC(C)(C)C)cc(C(C)(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C25H44/c1-12-13-19-14-20(24(8,9)17-22(2,3)4)16-21(15-19)25(10,11)18-23(5,6)7/h14-16H,12-13,17-18H2,1-11H3 |
| InChIKey | PKISXVSYGIVINF-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |