C25H41Br — CID 118583259
1-(8-bromo-2,4,4-trimethyloct-6-en-2-yl)-3,5-ditert-butylbenzene (PubChem CID 118583259) has the molecular formula C25H41Br and a molecular weight of 421.51 g/mol. Its IUPAC name is 1-(8-bromo-2,4,4-trimethyloct-6-en-2-yl)-3,5-ditert-butylbenzene.
| Compound Name | 1-(8-bromo-2,4,4-trimethyloct-6-en-2-yl)-3,5-ditert-butylbenzene |
|---|---|
| PubChem CID | 118583259 |
| Molecular Formula | C25H41Br |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 1-(8-bromo-2,4,4-trimethyloct-6-en-2-yl)-3,5-ditert-butylbenzene |
| SMILES | CC(C)(CC=CCBr)CC(C)(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H41Br/c1-22(2,3)19-15-20(23(4,5)6)17-21(16-19)25(9,10)18-24(7,8)13-11-12-14-26/h11-12,15-17H,13-14,18H2,1-10H3 |
| InChIKey | BNUQWZGLTHMSLL-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|