C14H22BrNO — CID 51983771
2-amino-6-bromo-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 51983771) has the molecular formula C14H22BrNO and a molecular weight of 300.24 g/mol. Its IUPAC name is 2-amino-6-bromo-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-amino-6-bromo-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 51983771 |
| Molecular Formula | C14H22BrNO |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-amino-6-bromo-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1cc(N)c(O)c(Br)c1 |
| InChI | InChI=1S/C14H22BrNO/c1-13(2,3)8-14(4,5)9-6-10(15)12(17)11(16)7-9/h6-7,17H,8,16H2,1-5H3 |
| InChIKey | POXBNQWUOQWEQL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|