C8H7BrF3NO2 — CID 142395987
2-amino-6-bromo-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol (PubChem CID 142395987) has the molecular formula C8H7BrF3NO2 and a molecular weight of 286.05 g/mol. Its IUPAC name is 2-amino-6-bromo-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol.
| Compound Name | 2-amino-6-bromo-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol |
|---|---|
| PubChem CID | 142395987 |
| Molecular Formula | C8H7BrF3NO2 |
| Molecular Weight | 286.05 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | 2-amino-6-bromo-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol |
| SMILES | Nc1cc(C(O)C(F)(F)F)cc(Br)c1O |
| InChI | InChI=1S/C8H7BrF3NO2/c9-4-1-3(2-5(13)6(4)14)7(15)8(10,11)12/h1-2,7,14-15H,13H2 |
| InChIKey | GUQSXMSGOHRLIN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.05 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|