C21H27N3O3 — CID 163601450
methyl 3-[3-tert-butyl-4-hydroxy-5-[[(6-iminocyclohexa-2,4-dien-1-ylidene)amino]methylamino]phenyl]propanoate (PubChem CID 163601450) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is methyl 3-[3-tert-butyl-4-hydroxy-5-[[(6-iminocyclohexa-2,4-dien-1-ylidene)amino]methylamino]phenyl]propanoate.
| Compound Name | methyl 3-[3-tert-butyl-4-hydroxy-5-[[(6-iminocyclohexa-2,4-dien-1-ylidene)amino]methylamino]phenyl]propanoate |
|---|---|
| PubChem CID | 163601450 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | methyl 3-[3-tert-butyl-4-hydroxy-5-[[(6-iminocyclohexa-2,4-dien-1-ylidene)amino]methylamino]phenyl]propanoate |
| SMILES | [H]/N=C1\C=CC=CC1=NCNc1cc(CCC(=O)OC)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H27N3O3/c1-21(2,3)15-11-14(9-10-19(25)27-4)12-18(20(15)26)24-13-23-17-8-6-5-7-16(17)22/h5-8,11-12,22,24,26H,9-10,13H2,1-4H3/b22-16+,23-17? |
| InChIKey | GXZZNYUILZLOAY-LKRQWNMRSA-N |
| XLogP | 3.75 |
| TPSA | 94.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|