C13H12N2 — CID 149004713
2-N-benzylcyclohexa-3,5-diene-1,2-diimine (PubChem CID 149004713) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-N-benzylcyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 2-N-benzylcyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 149004713 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-N-benzylcyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1\C=CC=C\C1=N/Cc1ccccc1 |
| InChI | InChI=1S/C13H12N2/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-9,14H,10H2/b14-12+,15-13+ |
| InChIKey | QAINQUBSBBWFFB-QUMQEAAQSA-N |
| XLogP | 2.77 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|