C34H32N4 — CID 101336824
1-N,4-N-dibenzyl-3,6-bis(benzylimino)cyclohexa-1,4-diene-1,4-diamine (PubChem CID 101336824) has the molecular formula C34H32N4 and a molecular weight of 496.66 g/mol. Its IUPAC name is 1-N,4-N-dibenzyl-3,6-bis(benzylimino)cyclohexa-1,4-diene-1,4-diamine.
| Compound Name | 1-N,4-N-dibenzyl-3,6-bis(benzylimino)cyclohexa-1,4-diene-1,4-diamine |
|---|---|
| PubChem CID | 101336824 |
| Molecular Formula | C34H32N4 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 1-N,4-N-dibenzyl-3,6-bis(benzylimino)cyclohexa-1,4-diene-1,4-diamine |
| SMILES | C1=C(NCc2ccccc2)/C(=N/Cc2ccccc2)C=C(NCc2ccccc2)/C1=N/Cc1ccccc1 |
| InChI | InChI=1S/C34H32N4/c1-5-13-27(14-6-1)23-35-31-21-33(37-25-29-17-9-3-10-18-29)34(38-26-30-19-11-4-12-20-30)22-32(31)36-24-28-15-7-2-8-16-28/h1-22,35,38H,23-26H2/b36-32+,37-33+ |
| InChIKey | HWYXCOBNMHFQEZ-CQHROMRQSA-N |
| XLogP | 6.63 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|