C13H17N — CID 59504538
N-benzyl-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexan-1-imine (PubChem CID 59504538) has the molecular formula C13H17N and a molecular weight of 197.35 g/mol. Its IUPAC name is N-benzyl-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexan-1-imine.
| Compound Name | N-benzyl-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexan-1-imine |
|---|---|
| PubChem CID | 59504538 |
| Molecular Formula | C13H17N |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.20 |
| IUPAC Name | N-benzyl-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexan-1-imine |
| SMILES | [2H]C1([2H])C(=NCc2ccccc2)C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C13H17N/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13/h1,3-4,7-8H,2,5-6,9-11H2/i2D2,5D2,6D2,9D2,10D2 |
| InChIKey | CYTHNXXBHKXYMA-VHPHYHOGSA-N |
| XLogP | 3.59 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|