C16H20N6 — CID 18977016
N,N'-bis(benzyldiazenyl)ethane-1,2-diamine (PubChem CID 18977016) has the molecular formula C16H20N6 and a molecular weight of 296.38 g/mol. Its IUPAC name is N,N'-bis(benzyldiazenyl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(benzyldiazenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 18977016 |
| Molecular Formula | C16H20N6 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N,N'-bis(benzyldiazenyl)ethane-1,2-diamine |
| SMILES | c1ccc(C/N=N/NCCN/N=N/Cc2ccccc2)cc1 |
| InChI | InChI=1S/C16H20N6/c1-3-7-15(8-4-1)13-19-21-17-11-12-18-22-20-14-16-9-5-2-6-10-16/h1-10H,11-14H2,(H,17,19)(H,18,20) |
| InChIKey | GZIZGKRKAGMBCZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|