C19H15N — CID 135032177
6-benzhydrylidenecyclohexa-2,4-dien-1-imine (PubChem CID 135032177) has the molecular formula C19H15N and a molecular weight of 257.34 g/mol. Its IUPAC name is 6-benzhydrylidenecyclohexa-2,4-dien-1-imine.
| Compound Name | 6-benzhydrylidenecyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 135032177 |
| Molecular Formula | C19H15N |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 6-benzhydrylidenecyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=CC1=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H15N/c20-18-14-8-7-13-17(18)19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,20H/b20-18+ |
| InChIKey | JMYDAHSAMHVWCF-CZIZESTLSA-N |
| XLogP | 4.63 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|