C15H12ClN2NaO3 — CID 132610159
sodium 2-[[(Z)-(3-chloro-6-iminocyclohexa-2,4-dien-1-ylidene)-phenylmethyl]-hydroxyamino]acetate (PubChem CID 132610159) has the molecular formula C15H12ClN2NaO3 and a molecular weight of 326.72 g/mol. Its IUPAC name is sodium 2-[[(Z)-(3-chloro-6-iminocyclohexa-2,4-dien-1-ylidene)-phenylmethyl]-hydroxyamino]acetate.
| Compound Name | sodium 2-[[(Z)-(3-chloro-6-iminocyclohexa-2,4-dien-1-ylidene)-phenylmethyl]-hydroxyamino]acetate |
|---|---|
| PubChem CID | 132610159 |
| Molecular Formula | C15H12ClN2NaO3 |
| Molecular Weight | 326.72 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | sodium 2-[[(Z)-(3-chloro-6-iminocyclohexa-2,4-dien-1-ylidene)-phenylmethyl]-hydroxyamino]acetate |
| SMILES | [H]/N=C1\C=CC(Cl)=C\C1=C(/c1ccccc1)N(O)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C15H13ClN2O3.Na/c16-11-6-7-13(17)12(8-11)15(18(21)9-14(19)20)10-4-2-1-3-5-10;/h1-8,17,21H,9H2,(H,19,20);/q;+1/p-1/b15-12-,17-13+; |
| InChIKey | OVVKLWOQTZSOTK-UPNOABRWSA-M |
| XLogP | -1.44 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.72 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|