C24H18N2 — CID 145117232
4-(3,5-diphenylphenyl)cyclohexa-3,5-diene-1,2-diimine (PubChem CID 145117232) has the molecular formula C24H18N2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-(3,5-diphenylphenyl)cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 4-(3,5-diphenylphenyl)cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 145117232 |
| Molecular Formula | C24H18N2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4-(3,5-diphenylphenyl)cyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1/C=C(c2cc(-c3ccccc3)cc(-c3ccccc3)c2)C=C/C1=N\[H] |
| InChI | InChI=1S/C24H18N2/c25-23-12-11-19(16-24(23)26)22-14-20(17-7-3-1-4-8-17)13-21(15-22)18-9-5-2-6-10-18/h1-16,25-26H/b25-23+,26-24- |
| InChIKey | QQSGXFUNJFZXAR-MRAZZECGSA-N |
| XLogP | 6.01 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|