C47H34N4 — CID 145117344
4-(9,10-diphenylanthracen-2-yl)cyclohexa-3,5-diene-1,2-diimine;4-quinolin-3-ylaniline (PubChem CID 145117344) has the molecular formula C47H34N4 and a molecular weight of 654.82 g/mol. Its IUPAC name is 4-(9,10-diphenylanthracen-2-yl)cyclohexa-3,5-diene-1,2-diimine;4-quinolin-3-ylaniline.
| Compound Name | 4-(9,10-diphenylanthracen-2-yl)cyclohexa-3,5-diene-1,2-diimine;4-quinolin-3-ylaniline |
|---|---|
| PubChem CID | 145117344 |
| Molecular Formula | C47H34N4 |
| Molecular Weight | 654.82 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 4-(9,10-diphenylanthracen-2-yl)cyclohexa-3,5-diene-1,2-diimine;4-quinolin-3-ylaniline |
| SMILES | Nc1ccc(-c2cnc3ccccc3c2)cc1.[H]/N=C1\C=CC(c2ccc3c(-c4ccccc4)c4ccccc4c(-c4ccccc4)c3c2)=C\C1=N/[H] |
| InChI | InChI=1S/C32H22N2.C15H12N2/c33-29-18-16-24(20-30(29)34)23-15-17-27-28(19-23)32(22-11-5-2-6-12-22)26-14-8-7-13-25(26)31(27)21-9-3-1-4-10-21;16-14-7-5-11(6-8-14)13-9-12-3-1-2-4-15(12)17-10-13/h1-20,33-34H;1-10H,16H2/b33-29+,34-30+; |
| InChIKey | BGERAYRVSKHDRW-BTVRLDFPSA-N |
| XLogP | 11.80 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.82 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|