C51H36N4 — CID 145117433
4-(9,10-diphenylanthracen-2-yl)cyclohexa-3,5-diene-1,2-diimine;4-isoquinolin-4-ylnaphthalen-1-amine (PubChem CID 145117433) has the molecular formula C51H36N4 and a molecular weight of 704.88 g/mol. Its IUPAC name is 4-(9,10-diphenylanthracen-2-yl)cyclohexa-3,5-diene-1,2-diimine;4-isoquinolin-4-ylnaphthalen-1-amine.
| Compound Name | 4-(9,10-diphenylanthracen-2-yl)cyclohexa-3,5-diene-1,2-diimine;4-isoquinolin-4-ylnaphthalen-1-amine |
|---|---|
| PubChem CID | 145117433 |
| Molecular Formula | C51H36N4 |
| Molecular Weight | 704.88 g/mol |
| Exact Mass | 704.29 |
| IUPAC Name | 4-(9,10-diphenylanthracen-2-yl)cyclohexa-3,5-diene-1,2-diimine;4-isoquinolin-4-ylnaphthalen-1-amine |
| SMILES | Nc1ccc(-c2cncc3ccccc23)c2ccccc12.[H]/N=C1/C=C(c2ccc3c(-c4ccccc4)c4ccccc4c(-c4ccccc4)c3c2)C=C/C1=N\[H] |
| InChI | InChI=1S/C32H22N2.C19H14N2/c33-29-18-16-24(20-30(29)34)23-15-17-27-28(19-23)32(22-11-5-2-6-12-22)26-14-8-7-13-25(26)31(27)21-9-3-1-4-10-21;20-19-10-9-16(15-7-3-4-8-17(15)19)18-12-21-11-13-5-1-2-6-14(13)18/h1-20,33-34H;1-12H,20H2/b33-29+,34-30-; |
| InChIKey | DSPVTIFKKQXSJV-RHFUCOHNSA-N |
| XLogP | 12.96 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.88 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|