C36H25N5 — CID 137276701
N-[(Z)-(6-imino-4-pyridin-3-ylcyclohexa-2,4-dien-1-ylidene)amino]-3-(10-pyridin-3-ylanthracen-9-yl)aniline (PubChem CID 137276701) has the molecular formula C36H25N5 and a molecular weight of 527.63 g/mol. Its IUPAC name is N-[(Z)-(6-imino-4-pyridin-3-ylcyclohexa-2,4-dien-1-ylidene)amino]-3-(10-pyridin-3-ylanthracen-9-yl)aniline.
| Compound Name | N-[(Z)-(6-imino-4-pyridin-3-ylcyclohexa-2,4-dien-1-ylidene)amino]-3-(10-pyridin-3-ylanthracen-9-yl)aniline |
|---|---|
| PubChem CID | 137276701 |
| Molecular Formula | C36H25N5 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | N-[(Z)-(6-imino-4-pyridin-3-ylcyclohexa-2,4-dien-1-ylidene)amino]-3-(10-pyridin-3-ylanthracen-9-yl)aniline |
| SMILES | [H]/N=C1\C=C(c2cccnc2)C=C\C1=N\Nc1cccc(-c2c3ccccc3c(-c3cccnc3)c3ccccc23)c1 |
| InChI | InChI=1S/C36H25N5/c37-33-21-24(26-9-6-18-38-22-26)16-17-34(33)41-40-28-11-5-8-25(20-28)35-29-12-1-3-14-31(29)36(27-10-7-19-39-23-27)32-15-4-2-13-30(32)35/h1-23,37,40H/b37-33+,41-34- |
| InChIKey | OCLQUQHYCSSVEF-GWXAOPGXSA-N |
| XLogP | 8.56 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|