C57H38N4 — CID 136629206
N-[(Z)-[6-imino-2,4-bis(10-phenylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-4-pyridin-3-ylaniline (PubChem CID 136629206) has the molecular formula C57H38N4 and a molecular weight of 778.96 g/mol. Its IUPAC name is N-[(Z)-[6-imino-2,4-bis(10-phenylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-4-pyridin-3-ylaniline.
| Compound Name | N-[(Z)-[6-imino-2,4-bis(10-phenylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-4-pyridin-3-ylaniline |
|---|---|
| PubChem CID | 136629206 |
| Molecular Formula | C57H38N4 |
| Molecular Weight | 778.96 g/mol |
| Exact Mass | 778.31 |
| IUPAC Name | N-[(Z)-[6-imino-2,4-bis(10-phenylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-4-pyridin-3-ylaniline |
| SMILES | [H]/N=C1\C=C(c2c3ccccc3c(-c3ccccc3)c3ccccc23)C=C(c2c3ccccc3c(-c3ccccc3)c3ccccc23)\C1=N\Nc1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C57H38N4/c58-52-35-41(55-45-23-9-7-21-43(45)53(38-16-3-1-4-17-38)44-22-8-10-24-46(44)55)34-51(57(52)61-60-42-31-29-37(30-32-42)40-20-15-33-59-36-40)56-49-27-13-11-25-47(49)54(39-18-5-2-6-19-39)48-26-12-14-28-50(48)56/h1-36,58,60H/b58-52+,61-57- |
| InChIKey | VYSUBYSGMCVZMQ-GFEVQNFFSA-N |
| XLogP | 14.66 |
| TPSA | 61.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.96 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|