C42H30N5+ — CID 172918573
[(6Z)-6-[[4-(10-pyridin-3-ylanthracen-9-yl)phenyl]hydrazinylidene]-3-(4-pyridin-3-ylphenyl)cyclohexa-2,4-dien-1-ylidene]azanium (PubChem CID 172918573) has the molecular formula C42H30N5+ and a molecular weight of 604.74 g/mol. Its IUPAC name is [(6Z)-6-[[4-(10-pyridin-3-ylanthracen-9-yl)phenyl]hydrazinylidene]-3-(4-pyridin-3-ylphenyl)cyclohexa-2,4-dien-1-ylidene]azanium.
| Compound Name | [(6Z)-6-[[4-(10-pyridin-3-ylanthracen-9-yl)phenyl]hydrazinylidene]-3-(4-pyridin-3-ylphenyl)cyclohexa-2,4-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 172918573 |
| Molecular Formula | C42H30N5+ |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | [(6Z)-6-[[4-(10-pyridin-3-ylanthracen-9-yl)phenyl]hydrazinylidene]-3-(4-pyridin-3-ylphenyl)cyclohexa-2,4-dien-1-ylidene]azanium |
| SMILES | [NH2+]=C1C=C(c2ccc(-c3cccnc3)cc2)C=C/C1=N/Nc1ccc(-c2c3ccccc3c(-c3cccnc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C42H29N5/c43-39-25-31(28-13-15-29(16-14-28)32-7-5-23-44-26-32)19-22-40(39)47-46-34-20-17-30(18-21-34)41-35-9-1-3-11-37(35)42(33-8-6-24-45-27-33)38-12-4-2-10-36(38)41/h1-27,43,46H/p+1/b43-39?,47-40- |
| InChIKey | DJMQOGDEYVVDEF-ZQQDVNKZSA-O |
| XLogP | 8.41 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|