C41H28N4 — CID 172986328
N-[(Z)-[6-imino-4-(10-naphthalen-1-ylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-4-pyridin-4-ylaniline (PubChem CID 172986328) has the molecular formula C41H28N4 and a molecular weight of 576.70 g/mol. Its IUPAC name is N-[(Z)-[6-imino-4-(10-naphthalen-1-ylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-4-pyridin-4-ylaniline.
| Compound Name | N-[(Z)-[6-imino-4-(10-naphthalen-1-ylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-4-pyridin-4-ylaniline |
|---|---|
| PubChem CID | 172986328 |
| Molecular Formula | C41H28N4 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | N-[(Z)-[6-imino-4-(10-naphthalen-1-ylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-4-pyridin-4-ylaniline |
| SMILES | [H]/N=C1\C=C(c2c3ccccc3c(-c3cccc4ccccc34)c3ccccc23)C=C\C1=N\Nc1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C41H28N4/c42-38-26-30(18-21-39(38)45-44-31-19-16-27(17-20-31)28-22-24-43-25-23-28)40-34-11-3-5-13-36(34)41(37-14-6-4-12-35(37)40)33-15-7-9-29-8-1-2-10-32(29)33/h1-26,42,44H/b42-38+,45-39- |
| InChIKey | VYNGZLLFAINJAC-LDOIWHRWSA-N |
| XLogP | 10.32 |
| TPSA | 61.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|