C41H29N4+ — CID 163911777
[[6-imino-4-(10-naphthalen-2-ylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-(3-pyridin-4-ylphenyl)azanium (PubChem CID 163911777) has the molecular formula C41H29N4+ and a molecular weight of 577.71 g/mol. Its IUPAC name is [[6-imino-4-(10-naphthalen-2-ylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-(3-pyridin-4-ylphenyl)azanium.
| Compound Name | [[6-imino-4-(10-naphthalen-2-ylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-(3-pyridin-4-ylphenyl)azanium |
|---|---|
| PubChem CID | 163911777 |
| Molecular Formula | C41H29N4+ |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | [[6-imino-4-(10-naphthalen-2-ylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-(3-pyridin-4-ylphenyl)azanium |
| SMILES | [H]/N=C1/C=C(c2c3ccccc3c(-c3ccc4ccccc4c3)c3ccccc23)C=CC1=N[NH2+]c1cccc(-c2ccncc2)c1 |
| InChI | InChI=1S/C41H28N4/c42-38-26-32(18-19-39(38)45-44-33-11-7-10-30(25-33)28-20-22-43-23-21-28)41-36-14-5-3-12-34(36)40(35-13-4-6-15-37(35)41)31-17-16-27-8-1-2-9-29(27)24-31/h1-26,42,44H/p+1/b42-38-,45-39? |
| InChIKey | QSTBJFPSNDPVQJ-RENYRFOESA-O |
| XLogP | 9.10 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|