C45H32N4 — CID 137245578
N-[(Z)-[6-imino-4-(10-naphthalen-2-ylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-4-quinolin-3-ylcyclohexa-1,3-dien-1-amine (PubChem CID 137245578) has the molecular formula C45H32N4 and a molecular weight of 628.78 g/mol. Its IUPAC name is N-[(Z)-[6-imino-4-(10-naphthalen-2-ylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-4-quinolin-3-ylcyclohexa-1,3-dien-1-amine.
| Compound Name | N-[(Z)-[6-imino-4-(10-naphthalen-2-ylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-4-quinolin-3-ylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 137245578 |
| Molecular Formula | C45H32N4 |
| Molecular Weight | 628.78 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | N-[(Z)-[6-imino-4-(10-naphthalen-2-ylanthracen-9-yl)cyclohexa-2,4-dien-1-ylidene]amino]-4-quinolin-3-ylcyclohexa-1,3-dien-1-amine |
| SMILES | [H]/N=C1\C=C(c2c3ccccc3c(-c3ccc4ccccc4c3)c3ccccc23)C=C\C1=N\NC1=CC=C(c2cnc3ccccc3c2)CC1 |
| InChI | InChI=1S/C45H32N4/c46-41-27-34(21-24-43(41)49-48-36-22-19-30(20-23-36)35-26-32-11-3-8-16-42(32)47-28-35)45-39-14-6-4-12-37(39)44(38-13-5-7-15-40(38)45)33-18-17-29-9-1-2-10-31(29)25-33/h1-19,21-22,24-28,46,48H,20,23H2/b46-41+,49-43- |
| InChIKey | QAARNAYUGWOECD-PEZOZIEYSA-N |
| XLogP | 11.04 |
| TPSA | 61.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.78 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|