C49H34N4 — CID 137143696
N-[(Z)-[6-imino-3,5-bis(4-naphthalen-1-ylphenyl)cyclohexa-2,4-dien-1-ylidene]amino]-3-pyridin-4-ylaniline (PubChem CID 137143696) has the molecular formula C49H34N4 and a molecular weight of 678.84 g/mol. Its IUPAC name is N-[(Z)-[6-imino-3,5-bis(4-naphthalen-1-ylphenyl)cyclohexa-2,4-dien-1-ylidene]amino]-3-pyridin-4-ylaniline.
| Compound Name | N-[(Z)-[6-imino-3,5-bis(4-naphthalen-1-ylphenyl)cyclohexa-2,4-dien-1-ylidene]amino]-3-pyridin-4-ylaniline |
|---|---|
| PubChem CID | 137143696 |
| Molecular Formula | C49H34N4 |
| Molecular Weight | 678.84 g/mol |
| Exact Mass | 678.28 |
| IUPAC Name | N-[(Z)-[6-imino-3,5-bis(4-naphthalen-1-ylphenyl)cyclohexa-2,4-dien-1-ylidene]amino]-3-pyridin-4-ylaniline |
| SMILES | [H]/N=C1/C(c2ccc(-c3cccc4ccccc34)cc2)=CC(c2ccc(-c3cccc4ccccc34)cc2)=C/C1=N/Nc1cccc(-c2ccncc2)c1 |
| InChI | InChI=1S/C49H34N4/c50-49-47(39-24-22-38(23-25-39)46-17-7-11-36-9-2-4-15-44(36)46)31-41(32-48(49)53-52-42-13-5-12-40(30-42)34-26-28-51-29-27-34)33-18-20-37(21-19-33)45-16-6-10-35-8-1-3-14-43(35)45/h1-32,50,52H/b50-49-,53-48- |
| InChIKey | JKVBRHVSCSXDBJ-LCGPAKBBSA-N |
| XLogP | 12.36 |
| TPSA | 61.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.84 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|