C25H17N3 — CID 145117365
4-(10-pyridin-3-ylanthracen-9-yl)cyclohexa-3,5-diene-1,2-diimine (PubChem CID 145117365) has the molecular formula C25H17N3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-(10-pyridin-3-ylanthracen-9-yl)cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 4-(10-pyridin-3-ylanthracen-9-yl)cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 145117365 |
| Molecular Formula | C25H17N3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 4-(10-pyridin-3-ylanthracen-9-yl)cyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1/C=C(c2c3ccccc3c(-c3cccnc3)c3ccccc23)C=C/C1=N\[H] |
| InChI | InChI=1S/C25H17N3/c26-22-12-11-16(14-23(22)27)24-18-7-1-3-9-20(18)25(17-6-5-13-28-15-17)21-10-4-2-8-19(21)24/h1-15,26-27H/b26-22+,27-23- |
| InChIKey | ALYZDVSUTPHNGF-FLPXOHCLSA-N |
| XLogP | 6.05 |
| TPSA | 60.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|