C7H10N2 — CID 143507678
4-methylcyclohex-3-ene-1,2-diimine (PubChem CID 143507678) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is 4-methylcyclohex-3-ene-1,2-diimine.
| Compound Name | 4-methylcyclohex-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 143507678 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 4-methylcyclohex-3-ene-1,2-diimine |
| SMILES | [H]/N=C1\C=C(C)CC\C1=N/[H] |
| InChI | InChI=1S/C7H10N2/c1-5-2-3-6(8)7(9)4-5/h4,8-9H,2-3H2,1H3/b8-6+,9-7+ |
| InChIKey | NTDKGADOHGMAEJ-CDJQDVQCSA-N |
| XLogP | 1.77 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|